C30H23NO4 — CID 135436754
(2R)-2-[[3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]methylideneamino]-3-phenylpropanoic acid (PubChem CID 135436754) has the molecular formula C30H23NO4 and a molecular weight of 461.52 g/mol. Its IUPAC name is (2R)-2-[[3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]methylideneamino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]methylideneamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 135436754 |
| Molecular Formula | C30H23NO4 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | (2R)-2-[[3-hydroxy-4-(2-hydroxynaphthalen-1-yl)naphthalen-2-yl]methylideneamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)/N=C/c1cc2ccccc2c(-c2c(O)ccc3ccccc23)c1O |
| InChI | InChI=1S/C30H23NO4/c32-26-15-14-20-10-4-6-12-23(20)27(26)28-24-13-7-5-11-21(24)17-22(29(28)33)18-31-25(30(34)35)16-19-8-2-1-3-9-19/h1-15,17-18,25,32-33H,16H2,(H,34,35)/b31-18+/t25-/m1/s1 |
| InChIKey | YUNGKQIZFJJVTR-QNSQCGTLSA-N |
| XLogP | 6.19 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|