C39H27N3O7 — CID 136698356
(2R)-2-[[3-hydroxy-4-[2-(4-nitrobenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl]methylideneamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 136698356) has the molecular formula C39H27N3O7 and a molecular weight of 649.66 g/mol. Its IUPAC name is (2R)-2-[[3-hydroxy-4-[2-(4-nitrobenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl]methylideneamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[[3-hydroxy-4-[2-(4-nitrobenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl]methylideneamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 136698356 |
| Molecular Formula | C39H27N3O7 |
| Molecular Weight | 649.66 g/mol |
| Exact Mass | 649.18 |
| IUPAC Name | (2R)-2-[[3-hydroxy-4-[2-(4-nitrobenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl]methylideneamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(Oc1ccc2ccccc2c1-c1c(O)c(/C=N/[C@H](Cc2c[nH]c3ccccc23)C(=O)O)cc2ccccc12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C39H27N3O7/c43-37-27(22-41-33(38(44)45)20-26-21-40-32-12-6-5-9-29(26)32)19-25-8-2-4-11-31(25)36(37)35-30-10-3-1-7-23(30)15-18-34(35)49-39(46)24-13-16-28(17-14-24)42(47)48/h1-19,21-22,33,40,43H,20H2,(H,44,45)/b41-22+/t33-/m1/s1 |
| InChIKey | KSZAQPBEMIVMOA-XDPOOMEQSA-N |
| XLogP | 8.09 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.66 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|