C16H20N2O2 — CID 10355890
(2R)-2-(2,2-dimethylpropylideneamino)-3-(1H-indol-3-yl)propanoic acid (PubChem CID 10355890) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (2R)-2-(2,2-dimethylpropylideneamino)-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-(2,2-dimethylpropylideneamino)-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 10355890 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (2R)-2-(2,2-dimethylpropylideneamino)-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)(C)/C=N/[C@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O2/c1-16(2,3)10-18-14(15(19)20)8-11-9-17-13-7-5-4-6-12(11)13/h4-7,9-10,14,17H,8H2,1-3H3,(H,19,20)/b18-10+/t14-/m1/s1 |
| InChIKey | OOUADQBATUYCKW-YFEUJDIGSA-N |
| XLogP | 3.28 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|