C17H22N2O3 — CID 90882540
(2S)-2-[acetyl(tert-butyl)amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 90882540) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2S)-2-[acetyl(tert-butyl)amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[acetyl(tert-butyl)amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 90882540 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (2S)-2-[acetyl(tert-butyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(=O)N([C@@H](Cc1c[nH]c2ccccc12)C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C17H22N2O3/c1-11(20)19(17(2,3)4)15(16(21)22)9-12-10-18-14-8-6-5-7-13(12)14/h5-8,10,15,18H,9H2,1-4H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | QUGYNPLVNXLMJC-HNNXBMFYSA-N |
| XLogP | 2.81 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |