C17H21N5O4S — CID 87828836
azane;(2S)-3-(1H-indol-3-yl)-2-[nitro(phenylsulfanyl)amino]propanoic acid (PubChem CID 87828836) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is azane;(2S)-3-(1H-indol-3-yl)-2-[nitro(phenylsulfanyl)amino]propanoic acid.
| Compound Name | azane;(2S)-3-(1H-indol-3-yl)-2-[nitro(phenylsulfanyl)amino]propanoic acid |
|---|---|
| PubChem CID | 87828836 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | azane;(2S)-3-(1H-indol-3-yl)-2-[nitro(phenylsulfanyl)amino]propanoic acid |
| SMILES | N.N.O=C(O)[C@H](Cc1c[nH]c2ccccc12)N(Sc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N3O4S.2H3N/c21-17(22)16(10-12-11-18-15-9-5-4-8-14(12)15)19(20(23)24)25-13-6-2-1-3-7-13;;/h1-9,11,16,18H,10H2,(H,21,22);2*1H3/t16-;;/m0../s1 |
| InChIKey | AUAGFBOPSPAUAD-SQKCAUCHSA-N |
| XLogP | 3.69 |
| TPSA | 169.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|