C20H17N3O2 — CID 135407769
(2S)-3-(1H-indol-3-yl)-2-(1H-indol-3-ylmethylideneamino)propanoic acid (PubChem CID 135407769) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is (2S)-3-(1H-indol-3-yl)-2-(1H-indol-3-ylmethylideneamino)propanoic acid.
| Compound Name | (2S)-3-(1H-indol-3-yl)-2-(1H-indol-3-ylmethylideneamino)propanoic acid |
|---|---|
| PubChem CID | 135407769 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | (2S)-3-(1H-indol-3-yl)-2-(1H-indol-3-ylmethylideneamino)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1c[nH]c2ccccc12)/N=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H17N3O2/c24-20(25)19(9-13-10-21-17-7-3-1-5-15(13)17)23-12-14-11-22-18-8-4-2-6-16(14)18/h1-8,10-12,19,21-22H,9H2,(H,24,25)/b23-12+/t19-/m0/s1 |
| InChIKey | JRDCKQUJWADVFK-DOUQRPAJSA-N |
| XLogP | 3.76 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|