C31H23NO5 — CID 136698344
(2S)-2-[[4-(2-benzoyloxynaphthalen-1-yl)-3-hydroxynaphthalen-2-yl]methylideneamino]propanoic acid (PubChem CID 136698344) has the molecular formula C31H23NO5 and a molecular weight of 489.53 g/mol. Its IUPAC name is (2S)-2-[[4-(2-benzoyloxynaphthalen-1-yl)-3-hydroxynaphthalen-2-yl]methylideneamino]propanoic acid.
| Compound Name | (2S)-2-[[4-(2-benzoyloxynaphthalen-1-yl)-3-hydroxynaphthalen-2-yl]methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 136698344 |
| Molecular Formula | C31H23NO5 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (2S)-2-[[4-(2-benzoyloxynaphthalen-1-yl)-3-hydroxynaphthalen-2-yl]methylideneamino]propanoic acid |
| SMILES | C[C@H](/N=C/c1cc2ccccc2c(-c2c(OC(=O)c3ccccc3)ccc3ccccc23)c1O)C(=O)O |
| InChI | InChI=1S/C31H23NO5/c1-19(30(34)35)32-18-23-17-22-12-6-8-14-25(22)28(29(23)33)27-24-13-7-5-9-20(24)15-16-26(27)37-31(36)21-10-3-2-4-11-21/h2-19,33H,1H3,(H,34,35)/b32-18+/t19-/m0/s1 |
| InChIKey | WWIIIBVXHCYOCO-BVDLXKEDSA-N |
| XLogP | 6.48 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|