C37H26N2O8 — CID 136698354
(2R)-2-[[3-hydroxy-4-[2-(4-nitrobenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl]methylideneamino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 136698354) has the molecular formula C37H26N2O8 and a molecular weight of 626.62 g/mol. Its IUPAC name is (2R)-2-[[3-hydroxy-4-[2-(4-nitrobenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl]methylideneamino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2R)-2-[[3-hydroxy-4-[2-(4-nitrobenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl]methylideneamino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 136698354 |
| Molecular Formula | C37H26N2O8 |
| Molecular Weight | 626.62 g/mol |
| Exact Mass | 626.17 |
| IUPAC Name | (2R)-2-[[3-hydroxy-4-[2-(4-nitrobenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl]methylideneamino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(Oc1ccc2ccccc2c1-c1c(O)c(/C=N/[C@H](Cc2ccc(O)cc2)C(=O)O)cc2ccccc12)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C37H26N2O8/c40-28-16-9-22(10-17-28)19-31(36(42)43)38-21-26-20-25-6-2-4-8-30(25)34(35(26)41)33-29-7-3-1-5-23(29)13-18-32(33)47-37(44)24-11-14-27(15-12-24)39(45)46/h1-18,20-21,31,40-41H,19H2,(H,42,43)/b38-21+/t31-/m1/s1 |
| InChIKey | BQEDQQXXQCPGFR-LQXUJBIFSA-N |
| XLogP | 7.31 |
| TPSA | 159.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.62 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|