C41H30N6O8 — CID 56696784
[4-[[4-benzoyloxy-3-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]phenyl]methyl]-2-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 56696784) has the molecular formula C41H30N6O8 and a molecular weight of 734.73 g/mol. Its IUPAC name is [4-[[4-benzoyloxy-3-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]phenyl]methyl]-2-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[[4-benzoyloxy-3-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]phenyl]methyl]-2-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 56696784 |
| Molecular Formula | C41H30N6O8 |
| Molecular Weight | 734.73 g/mol |
| Exact Mass | 734.21 |
| IUPAC Name | [4-[[4-benzoyloxy-3-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]phenyl]methyl]-2-[(E)-[(4-nitrophenyl)hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(Oc1ccc(Cc2ccc(OC(=O)c3ccccc3)c(/C=N/Nc3ccc([N+](=O)[O-])cc3)c2)cc1/C=N/Nc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C41H30N6O8/c48-40(30-7-3-1-4-8-30)54-38-21-11-28(24-32(38)26-42-44-34-13-17-36(18-14-34)46(50)51)23-29-12-22-39(55-41(49)31-9-5-2-6-10-31)33(25-29)27-43-45-35-15-19-37(20-16-35)47(52)53/h1-22,24-27,44-45H,23H2/b42-26+,43-27+ |
| InChIKey | ZZCDEBNLWBESAU-RFCNWNEUSA-N |
| XLogP | 8.42 |
| TPSA | 187.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.73 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|