C33H30N6O8 — CID 3627330
[2-[[(4-nitrophenyl)hydrazinylidene]methyl]-4-[[3-[[(4-nitrophenyl)hydrazinylidene]methyl]-4-propanoyloxyphenyl]methyl]phenyl] propanoate (PubChem CID 3627330) has the molecular formula C33H30N6O8 and a molecular weight of 638.64 g/mol. Its IUPAC name is [2-[[(4-nitrophenyl)hydrazinylidene]methyl]-4-[[3-[[(4-nitrophenyl)hydrazinylidene]methyl]-4-propanoyloxyphenyl]methyl]phenyl] propanoate.
| Compound Name | [2-[[(4-nitrophenyl)hydrazinylidene]methyl]-4-[[3-[[(4-nitrophenyl)hydrazinylidene]methyl]-4-propanoyloxyphenyl]methyl]phenyl] propanoate |
|---|---|
| PubChem CID | 3627330 |
| Molecular Formula | C33H30N6O8 |
| Molecular Weight | 638.64 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | [2-[[(4-nitrophenyl)hydrazinylidene]methyl]-4-[[3-[[(4-nitrophenyl)hydrazinylidene]methyl]-4-propanoyloxyphenyl]methyl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(Cc2ccc(OC(=O)CC)c(C=NNc3ccc([N+](=O)[O-])cc3)c2)cc1C=NNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C33H30N6O8/c1-3-32(40)46-30-15-5-22(18-24(30)20-34-36-26-7-11-28(12-8-26)38(42)43)17-23-6-16-31(47-33(41)4-2)25(19-23)21-35-37-27-9-13-29(14-10-27)39(44)45/h5-16,18-21,36-37H,3-4,17H2,1-2H3 |
| InChIKey | BHDBEHRXNSCNJA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 187.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|