C19H16ClN3O5 — CID 135855178
methyl (2R)-2-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(1H-indol-3-yl)propanoate (PubChem CID 135855178) has the molecular formula C19H16ClN3O5 and a molecular weight of 401.81 g/mol. Its IUPAC name is methyl (2R)-2-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2R)-2-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 135855178 |
| Molecular Formula | C19H16ClN3O5 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | methyl (2R)-2-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-3-(1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)/N=C/c1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H16ClN3O5/c1-28-19(25)16(7-11-9-21-15-5-3-2-4-14(11)15)22-10-12-6-13(20)8-17(18(12)24)23(26)27/h2-6,8-10,16,21,24H,7H2,1H3/b22-10+/t16-/m1/s1 |
| InChIKey | OFXQPDDAYPWHBX-YJCKXXIQSA-N |
| XLogP | 3.64 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|