C16H13N5O6 — CID 102373747
(2R)-2-[(4,6-dinitro-2-pyridinyl)amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 102373747) has the molecular formula C16H13N5O6 and a molecular weight of 371.31 g/mol. Its IUPAC name is (2R)-2-[(4,6-dinitro-2-pyridinyl)amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[(4,6-dinitro-2-pyridinyl)amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 102373747 |
| Molecular Formula | C16H13N5O6 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | (2R)-2-[(4,6-dinitro-2-pyridinyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1c[nH]c2ccccc12)Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C16H13N5O6/c22-16(23)13(5-9-8-17-12-4-2-1-3-11(9)12)18-14-6-10(20(24)25)7-15(19-14)21(26)27/h1-4,6-8,13,17H,5H2,(H,18,19)(H,22,23)/t13-/m1/s1 |
| InChIKey | LPWKBZZYOSFJCY-CYBMUJFWSA-N |
| XLogP | 2.49 |
| TPSA | 164.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|