C21H16ClN3O4 — CID 45256702
2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-6-chloroquinoline-3-carboxylic acid (PubChem CID 45256702) has the molecular formula C21H16ClN3O4 and a molecular weight of 409.83 g/mol. Its IUPAC name is 2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-6-chloroquinoline-3-carboxylic acid.
| Compound Name | 2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-6-chloroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 45256702 |
| Molecular Formula | C21H16ClN3O4 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-[[1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-6-chloroquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(Cl)ccc2nc1NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H16ClN3O4/c22-13-5-6-16-11(7-13)8-15(20(26)27)19(24-16)25-18(21(28)29)9-12-10-23-17-4-2-1-3-14(12)17/h1-8,10,18,23H,9H2,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | KYMMOIFCRATTDM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 115.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |