C19H15ClN2O5 — CID 67357599
2-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-6-chloroquinoline-3-carboxylic acid (PubChem CID 67357599) has the molecular formula C19H15ClN2O5 and a molecular weight of 386.79 g/mol. Its IUPAC name is 2-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-6-chloroquinoline-3-carboxylic acid.
| Compound Name | 2-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-6-chloroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67357599 |
| Molecular Formula | C19H15ClN2O5 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 2-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-6-chloroquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(Cl)ccc2nc1NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C19H15ClN2O5/c20-12-3-6-15-11(8-12)9-14(18(24)25)17(21-15)22-16(19(26)27)7-10-1-4-13(23)5-2-10/h1-6,8-9,16,23H,7H2,(H,21,22)(H,24,25)(H,26,27) |
| InChIKey | SQPSZYOPTZIKQZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |