C13H11ClN2O5 — CID 67359553
2-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-6-chloroquinoline-3-carboxylic acid (PubChem CID 67359553) has the molecular formula C13H11ClN2O5 and a molecular weight of 310.69 g/mol. Its IUPAC name is 2-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-6-chloroquinoline-3-carboxylic acid.
| Compound Name | 2-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-6-chloroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67359553 |
| Molecular Formula | C13H11ClN2O5 |
| Molecular Weight | 310.69 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[[(1S)-1-carboxy-2-hydroxyethyl]amino]-6-chloroquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(Cl)ccc2nc1N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C13H11ClN2O5/c14-7-1-2-9-6(3-7)4-8(12(18)19)11(15-9)16-10(5-17)13(20)21/h1-4,10,17H,5H2,(H,15,16)(H,18,19)(H,20,21)/t10-/m0/s1 |
| InChIKey | GPSANESBNQJRSG-JTQLQIEISA-N |
| XLogP | 1.44 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.69 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |