C12H9ClN2O4 — CID 67358680
2-(carboxymethylamino)-6-chloroquinoline-3-carboxylic acid (PubChem CID 67358680) has the molecular formula C12H9ClN2O4 and a molecular weight of 280.67 g/mol. Its IUPAC name is 2-(carboxymethylamino)-6-chloroquinoline-3-carboxylic acid.
| Compound Name | 2-(carboxymethylamino)-6-chloroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67358680 |
| Molecular Formula | C12H9ClN2O4 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-(carboxymethylamino)-6-chloroquinoline-3-carboxylic acid |
| SMILES | O=C(O)CNc1nc2ccc(Cl)cc2cc1C(=O)O |
| InChI | InChI=1S/C12H9ClN2O4/c13-7-1-2-9-6(3-7)4-8(12(18)19)11(15-9)14-5-10(16)17/h1-4H,5H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | YNGZZNNAMZJXPU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |