C17H13ClN2O4S — CID 45255966
2-[(1-carboxy-2-thiophen-2-ylethyl)amino]-6-chloroquinoline-3-carboxylic acid (PubChem CID 45255966) has the molecular formula C17H13ClN2O4S and a molecular weight of 376.82 g/mol. Its IUPAC name is 2-[(1-carboxy-2-thiophen-2-ylethyl)amino]-6-chloroquinoline-3-carboxylic acid.
| Compound Name | 2-[(1-carboxy-2-thiophen-2-ylethyl)amino]-6-chloroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 45255966 |
| Molecular Formula | C17H13ClN2O4S |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 2-[(1-carboxy-2-thiophen-2-ylethyl)amino]-6-chloroquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cc2cc(Cl)ccc2nc1NC(Cc1cccs1)C(=O)O |
| InChI | InChI=1S/C17H13ClN2O4S/c18-10-3-4-13-9(6-10)7-12(16(21)22)15(19-13)20-14(17(23)24)8-11-2-1-5-25-11/h1-7,14H,8H2,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | VYMNQUIYYPMZKA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |