C24H19ClN4O5 — CID 67357640
2-[[(1S)-2-[4-[(5-amino-2-pyridinyl)oxy]phenyl]-1-carboxyethyl]amino]-6-chloroquinoline-3-carboxylic acid (PubChem CID 67357640) has the molecular formula C24H19ClN4O5 and a molecular weight of 478.89 g/mol. Its IUPAC name is 2-[[(1S)-2-[4-[(5-amino-2-pyridinyl)oxy]phenyl]-1-carboxyethyl]amino]-6-chloroquinoline-3-carboxylic acid.
| Compound Name | 2-[[(1S)-2-[4-[(5-amino-2-pyridinyl)oxy]phenyl]-1-carboxyethyl]amino]-6-chloroquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 67357640 |
| Molecular Formula | C24H19ClN4O5 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-[[(1S)-2-[4-[(5-amino-2-pyridinyl)oxy]phenyl]-1-carboxyethyl]amino]-6-chloroquinoline-3-carboxylic acid |
| SMILES | Nc1ccc(Oc2ccc(C[C@H](Nc3nc4ccc(Cl)cc4cc3C(=O)O)C(=O)O)cc2)nc1 |
| InChI | InChI=1S/C24H19ClN4O5/c25-15-3-7-19-14(10-15)11-18(23(30)31)22(28-19)29-20(24(32)33)9-13-1-5-17(6-2-13)34-21-8-4-16(26)12-27-21/h1-8,10-12,20H,9,26H2,(H,28,29)(H,30,31)(H,32,33)/t20-/m0/s1 |
| InChIKey | IUSOBZLNDUFIQX-FQEVSTJZSA-N |
| XLogP | 4.46 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_A(8)', 'substructure': 'N/A'} |
|---|