C23H18N4O2S — CID 91964446
3-(1H-indol-3-yl)-2-[(2-thiophen-2-ylquinazolin-4-yl)amino]propanoic acid (PubChem CID 91964446) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-[(2-thiophen-2-ylquinazolin-4-yl)amino]propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-[(2-thiophen-2-ylquinazolin-4-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 91964446 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-[(2-thiophen-2-ylquinazolin-4-yl)amino]propanoic acid |
| SMILES | O=C(O)C(Cc1c[nH]c2ccccc12)Nc1nc(-c2cccs2)nc2ccccc12 |
| InChI | InChI=1S/C23H18N4O2S/c28-23(29)19(12-14-13-24-17-8-3-1-6-15(14)17)26-21-16-7-2-4-9-18(16)25-22(27-21)20-10-5-11-30-20/h1-11,13,19,24H,12H2,(H,28,29)(H,25,26,27) |
| InChIKey | YEXXPIWIZZYMFV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |