C82H64CuN2O4P2 — CID 139213573
copper;bis(3-[[(1S)-1-(2-diphenylphosphanylphenyl)ethyl]iminomethyl]-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol) (PubChem CID 139213573) has the molecular formula C82H64CuN2O4P2 and a molecular weight of 1266.92 g/mol. Its IUPAC name is copper;bis(3-[[(1S)-1-(2-diphenylphosphanylphenyl)ethyl]iminomethyl]-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol).
| Compound Name | copper;bis(3-[[(1S)-1-(2-diphenylphosphanylphenyl)ethyl]iminomethyl]-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol) |
|---|---|
| PubChem CID | 139213573 |
| Molecular Formula | C82H64CuN2O4P2 |
| Molecular Weight | 1266.92 g/mol |
| Exact Mass | 1265.36 |
| IUPAC Name | copper;bis(3-[[(1S)-1-(2-diphenylphosphanylphenyl)ethyl]iminomethyl]-1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol) |
| SMILES | C[C@H](/N=C/c1cc2ccccc2c(-c2c(O)ccc3ccccc23)c1O)c1ccccc1P(c1ccccc1)c1ccccc1.C[C@H](/N=C/c1cc2ccccc2c(-c2c(O)ccc3ccccc23)c1O)c1ccccc1P(c1ccccc1)c1ccccc1.[Cu] |
| InChI | InChI=1S/2C41H32NO2P.Cu/c2*1-28(34-20-12-13-23-38(34)45(32-16-4-2-5-17-32)33-18-6-3-7-19-33)42-27-31-26-30-15-9-11-22-36(30)40(41(31)44)39-35-21-10-8-14-29(35)24-25-37(39)43;/h2*2-28,43-44H,1H3;/b2*42-27+;/t2*28-;/m00./s1 |
| InChIKey | YZUFLJSEFKCJMZ-DTJIUNJXSA-N |
| XLogP | 18.02 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 91 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1266.92 |
| LogP ≤ 5 | 18.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|