C17H18N4O3 — CID 136717278
(2S)-2-[[5-(diaminomethylideneamino)-2-hydroxyphenyl]methylideneamino]-3-phenylpropanoic acid (PubChem CID 136717278) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is (2S)-2-[[5-(diaminomethylideneamino)-2-hydroxyphenyl]methylideneamino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[5-(diaminomethylideneamino)-2-hydroxyphenyl]methylideneamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 136717278 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (2S)-2-[[5-(diaminomethylideneamino)-2-hydroxyphenyl]methylideneamino]-3-phenylpropanoic acid |
| SMILES | NC(N)=Nc1ccc(O)c(/C=N/[C@@H](Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C17H18N4O3/c18-17(19)21-13-6-7-15(22)12(9-13)10-20-14(16(23)24)8-11-4-2-1-3-5-11/h1-7,9-10,14,22H,8H2,(H,23,24)(H4,18,19,21)/b20-10+/t14-/m0/s1 |
| InChIKey | NGYAKWXMNCVRMN-ANKPHQHTSA-N |
| XLogP | 1.41 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|