C20H22Cl2N2O3 — CID 136867324
(2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-hydroxyphenyl)methylideneamino]propanoic acid (PubChem CID 136867324) has the molecular formula C20H22Cl2N2O3 and a molecular weight of 409.31 g/mol. Its IUPAC name is (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-hydroxyphenyl)methylideneamino]propanoic acid.
| Compound Name | (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-hydroxyphenyl)methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 136867324 |
| Molecular Formula | C20H22Cl2N2O3 |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (2S)-3-[4-[bis(2-chloroethyl)amino]phenyl]-2-[(2-hydroxyphenyl)methylideneamino]propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(N(CCCl)CCCl)cc1)/N=C/c1ccccc1O |
| InChI | InChI=1S/C20H22Cl2N2O3/c21-9-11-24(12-10-22)17-7-5-15(6-8-17)13-18(20(26)27)23-14-16-3-1-2-4-19(16)25/h1-8,14,18,25H,9-13H2,(H,26,27)/b23-14+/t18-/m0/s1 |
| InChIKey | FUYPMEPXCNRVER-TTXZLZEXSA-N |
| XLogP | 3.79 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|