About 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid
2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid (PubChem CID 3713857) has the molecular formula C10H13N3O5S
and a molecular weight of 287.30 g/mol. Its IUPAC name is 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid.
Molecular Properties
| Compound Name | 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid |
| PubChem CID | 3713857 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(/N=C/c1c(O)[nH]c(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C10H13N3O5S/c1-19-3-2-6(9(16)17)11-4-5-7(14)12-10(18)13-8(5)15/h4,6H,2-3H2,1H3,(H,16,17)(H3,12,13,14,15,18)/b11-4+ |
| InChIKey | KXIKADSDBJZXPI-NYYWCZLTSA-N |
| XLogP | -0.61 |
| TPSA | 135.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid?
The IUPAC name of 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid (CID 3713857) is 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid.
What is the SMILES notation for 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid?
The canonical SMILES for 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid is CSCCC(/N=C/c1c(O)[nH]c(=O)[nH]c1=O)C(=O)O.
What is the InChIKey of 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid?
The InChIKey is KXIKADSDBJZXPI-NYYWCZLTSA-N. The full InChI is InChI=1S/C10H13N3O5S/c1-19-3-2-6(9(16)17)11-4-5-7(14)12-10(18)13-8(5)15/h4,6H,2-3H2,1H3,(H,16,17)(H3,12,13,14,15,18)/b11-4+.
What are the key properties of 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid?
2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid has a molecular weight of 287.30 g/mol, XLogP of -0.61, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)methylideneamino]-4-methylsulfanylbutanoic acid is sourced from PubChem (CID 3713857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).