C6H7N3O2 — CID 23528312
(E)-3-(5-methyl-1H-1,2,4-triazol-3-yl)prop-2-enoic acid (PubChem CID 23528312) has the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. Its IUPAC name is (E)-3-(5-methyl-1H-1,2,4-triazol-3-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(5-methyl-1H-1,2,4-triazol-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 23528312 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | (E)-3-(5-methyl-1H-1,2,4-triazol-3-yl)prop-2-enoic acid |
| SMILES | Cc1nc(/C=C/C(=O)O)n[nH]1 |
| InChI | InChI=1S/C6H7N3O2/c1-4-7-5(9-8-4)2-3-6(10)11/h2-3H,1H3,(H,10,11)(H,7,8,9)/b3-2+ |
| InChIKey | KPZQYHKMPZSUJN-NSCUHMNNSA-N |
| XLogP | 0.21 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|