2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid

C7H11N3O2 — CID 18739550

IUPAC2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid
SMILESCc1nc(C(C)(C)C(=O)O)n[nH]1
InChIInChI=1S/C7H11N3O2/c1-4-8-5(10-9-4)7(2,3)6(11)12/h1-3H3,(H,11,12)(H,8,9,10)
InChIKeyDNQLMFHHBPJPBN-UHFFFAOYSA-N
MW169.18 g/mol
LogP0.48
Rot. Bonds2

About 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid

2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid (PubChem CID 18739550) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid.

Molecular Properties

Compound Name2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid
PubChem CID18739550
Molecular FormulaC7H11N3O2
Molecular Weight169.18 g/mol
Exact Mass169.09
IUPAC Name2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid
SMILESCc1nc(C(C)(C)C(=O)O)n[nH]1
InChIInChI=1S/C7H11N3O2/c1-4-8-5(10-9-4)7(2,3)6(11)12/h1-3H3,(H,11,12)(H,8,9,10)
InChIKeyDNQLMFHHBPJPBN-UHFFFAOYSA-N
XLogP0.48
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.18
LogP ≤ 50.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid?
The IUPAC name of 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid (CID 18739550) is 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid.
What is the SMILES notation for 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid?
The canonical SMILES for 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid is Cc1nc(C(C)(C)C(=O)O)n[nH]1.
What is the InChIKey of 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid?
The InChIKey is DNQLMFHHBPJPBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-4-8-5(10-9-4)7(2,3)6(11)12/h1-3H3,(H,11,12)(H,8,9,10).
What are the key properties of 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid?
2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid has a molecular weight of 169.18 g/mol, XLogP of 0.48, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(5-methyl-1H-1,2,4-triazol-3-yl)propanoic acid is sourced from PubChem (CID 18739550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).