C11H19N3O2S — CID 106714480
2,2-dimethyl-6-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid (PubChem CID 106714480) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is 2,2-dimethyl-6-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid.
| Compound Name | 2,2-dimethyl-6-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid |
|---|---|
| PubChem CID | 106714480 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2,2-dimethyl-6-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]hexanoic acid |
| SMILES | Cc1nc(SCCCCC(C)(C)C(=O)O)n[nH]1 |
| InChI | InChI=1S/C11H19N3O2S/c1-8-12-10(14-13-8)17-7-5-4-6-11(2,3)9(15)16/h4-7H2,1-3H3,(H,15,16)(H,12,13,14) |
| InChIKey | TXEMIRNYOCGVKJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|