C10H20N4OS — CID 62580317
N-(2-methoxyethyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]butan-1-amine (PubChem CID 62580317) has the molecular formula C10H20N4OS and a molecular weight of 244.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]butan-1-amine.
| Compound Name | N-(2-methoxyethyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]butan-1-amine |
|---|---|
| PubChem CID | 62580317 |
| Molecular Formula | C10H20N4OS |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | N-(2-methoxyethyl)-4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]butan-1-amine |
| SMILES | COCCNCCCCSc1n[nH]c(C)n1 |
| InChI | InChI=1S/C10H20N4OS/c1-9-12-10(14-13-9)16-8-4-3-5-11-6-7-15-2/h11H,3-8H2,1-2H3,(H,12,13,14) |
| InChIKey | RAPSDLPGDQQRNS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|