C13H17N3O2S — CID 39020131
3-[3-(4-methoxyphenoxy)propylsulfanyl]-5-methyl-1H-1,2,4-triazole (PubChem CID 39020131) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenoxy)propylsulfanyl]-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-[3-(4-methoxyphenoxy)propylsulfanyl]-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 39020131 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-[3-(4-methoxyphenoxy)propylsulfanyl]-5-methyl-1H-1,2,4-triazole |
| SMILES | COc1ccc(OCCCSc2n[nH]c(C)n2)cc1 |
| InChI | InChI=1S/C13H17N3O2S/c1-10-14-13(16-15-10)19-9-3-8-18-12-6-4-11(17-2)5-7-12/h4-7H,3,8-9H2,1-2H3,(H,14,15,16) |
| InChIKey | CTZDPEHGONFZRQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|