C17H16ClN3O2S — CID 7896445
3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole (PubChem CID 7896445) has the molecular formula C17H16ClN3O2S and a molecular weight of 361.85 g/mol. Its IUPAC name is 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole.
| Compound Name | 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 7896445 |
| Molecular Formula | C17H16ClN3O2S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-(4-methoxyphenyl)-1H-1,2,4-triazole |
| SMILES | COc1ccc(-c2nc(SCCOc3ccc(Cl)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C17H16ClN3O2S/c1-22-14-6-2-12(3-7-14)16-19-17(21-20-16)24-11-10-23-15-8-4-13(18)5-9-15/h2-9H,10-11H2,1H3,(H,19,20,21) |
| InChIKey | KOBDUJMDFWURNM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|