C16H14FN3OS — CID 7556320
3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-phenyl-1H-1,2,4-triazole (PubChem CID 7556320) has the molecular formula C16H14FN3OS and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-phenyl-1H-1,2,4-triazole.
| Compound Name | 3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-phenyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 7556320 |
| Molecular Formula | C16H14FN3OS |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-phenyl-1H-1,2,4-triazole |
| SMILES | Fc1ccc(OCCSc2n[nH]c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H14FN3OS/c17-13-6-8-14(9-7-13)21-10-11-22-16-18-15(19-20-16)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,18,19,20) |
| InChIKey | AMKZFIIVRIXMSM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|