C11H22N4OS — CID 55092656
2-butoxy-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]ethanamine (PubChem CID 55092656) has the molecular formula C11H22N4OS and a molecular weight of 258.39 g/mol. Its IUPAC name is 2-butoxy-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]ethanamine.
| Compound Name | 2-butoxy-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]ethanamine |
|---|---|
| PubChem CID | 55092656 |
| Molecular Formula | C11H22N4OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-butoxy-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]ethanamine |
| SMILES | CCCCOCCNCCSc1n[nH]c(C)n1 |
| InChI | InChI=1S/C11H22N4OS/c1-3-4-7-16-8-5-12-6-9-17-11-13-10(2)14-15-11/h12H,3-9H2,1-2H3,(H,13,14,15) |
| InChIKey | WKPUARQKXQOKQN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|