C10H19N3O2S — CID 63629318
3-(3,3-diethoxypropylsulfanyl)-5-methyl-1H-1,2,4-triazole (PubChem CID 63629318) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is 3-(3,3-diethoxypropylsulfanyl)-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-(3,3-diethoxypropylsulfanyl)-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 63629318 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-(3,3-diethoxypropylsulfanyl)-5-methyl-1H-1,2,4-triazole |
| SMILES | CCOC(CCSc1n[nH]c(C)n1)OCC |
| InChI | InChI=1S/C10H19N3O2S/c1-4-14-9(15-5-2)6-7-16-10-11-8(3)12-13-10/h9H,4-7H2,1-3H3,(H,11,12,13) |
| InChIKey | MFDFRHDRPHMDKM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|