C9H18N4O2S — CID 81094533
3-(3,3-diethoxypropylsulfanyl)-1H-1,2,4-triazol-5-amine (PubChem CID 81094533) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is 3-(3,3-diethoxypropylsulfanyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-(3,3-diethoxypropylsulfanyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 81094533 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-(3,3-diethoxypropylsulfanyl)-1H-1,2,4-triazol-5-amine |
| SMILES | CCOC(CCSc1n[nH]c(N)n1)OCC |
| InChI | InChI=1S/C9H18N4O2S/c1-3-14-7(15-4-2)5-6-16-9-11-8(10)12-13-9/h7H,3-6H2,1-2H3,(H3,10,11,12,13) |
| InChIKey | KHANNUUPAHIQKU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|