C11H24N4O3SSi — CID 132554513
3-(3-triethoxysilylpropylsulfanyl)-1H-1,2,4-triazol-5-amine (PubChem CID 132554513) has the molecular formula C11H24N4O3SSi and a molecular weight of 320.49 g/mol. Its IUPAC name is 3-(3-triethoxysilylpropylsulfanyl)-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-(3-triethoxysilylpropylsulfanyl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 132554513 |
| Molecular Formula | C11H24N4O3SSi |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-(3-triethoxysilylpropylsulfanyl)-1H-1,2,4-triazol-5-amine |
| SMILES | CCO[Si](CCCSc1n[nH]c(N)n1)(OCC)OCC |
| InChI | InChI=1S/C11H24N4O3SSi/c1-4-16-20(17-5-2,18-6-3)9-7-8-19-11-13-10(12)14-15-11/h4-9H2,1-3H3,(H3,12,13,14,15) |
| InChIKey | YQYLRHOZPZXJKN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|