C9H19N3O3S2Si — CID 140758675
trimethoxy-[3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)sulfanyl]propyl]silane (PubChem CID 140758675) has the molecular formula C9H19N3O3S2Si and a molecular weight of 309.49 g/mol. Its IUPAC name is trimethoxy-[3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)sulfanyl]propyl]silane.
| Compound Name | trimethoxy-[3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)sulfanyl]propyl]silane |
|---|---|
| PubChem CID | 140758675 |
| Molecular Formula | C9H19N3O3S2Si |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | trimethoxy-[3-[(3-methylsulfanyl-1H-1,2,4-triazol-5-yl)sulfanyl]propyl]silane |
| SMILES | CO[Si](CCCSc1nc(SC)n[nH]1)(OC)OC |
| InChI | InChI=1S/C9H19N3O3S2Si/c1-13-18(14-2,15-3)7-5-6-17-9-10-8(16-4)11-12-9/h5-7H2,1-4H3,(H,10,11,12) |
| InChIKey | IAVYIQXCJVMYNS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|