C10H18N4O2S — CID 15017028
methyl N-[2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]carbamate (PubChem CID 15017028) has the molecular formula C10H18N4O2S and a molecular weight of 258.35 g/mol. Its IUPAC name is methyl N-[2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]carbamate.
| Compound Name | methyl N-[2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 15017028 |
| Molecular Formula | C10H18N4O2S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | methyl N-[2-[(5-tert-butyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]carbamate |
| SMILES | COC(=O)NCCSc1n[nH]c(C(C)(C)C)n1 |
| InChI | InChI=1S/C10H18N4O2S/c1-10(2,3)7-12-8(14-13-7)17-6-5-11-9(15)16-4/h5-6H2,1-4H3,(H,11,15)(H,12,13,14) |
| InChIKey | ADAHBRRVVBUUCZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|