C11H22N4S — CID 62581571
3,3-dimethyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]butan-1-amine (PubChem CID 62581571) has the molecular formula C11H22N4S and a molecular weight of 242.39 g/mol. Its IUPAC name is 3,3-dimethyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]butan-1-amine.
| Compound Name | 3,3-dimethyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]butan-1-amine |
|---|---|
| PubChem CID | 62581571 |
| Molecular Formula | C11H22N4S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 3,3-dimethyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]butan-1-amine |
| SMILES | Cc1nc(SCCNCCC(C)(C)C)n[nH]1 |
| InChI | InChI=1S/C11H22N4S/c1-9-13-10(15-14-9)16-8-7-12-6-5-11(2,3)4/h12H,5-8H2,1-4H3,(H,13,14,15) |
| InChIKey | RGLFLBBOYSTRDM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|