C11H23N5S — CID 62580503
N',N'-diethyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]ethane-1,2-diamine (PubChem CID 62580503) has the molecular formula C11H23N5S and a molecular weight of 257.41 g/mol. Its IUPAC name is N',N'-diethyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62580503 |
| Molecular Formula | C11H23N5S |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | N',N'-diethyl-N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCSc1n[nH]c(C)n1 |
| InChI | InChI=1S/C11H23N5S/c1-4-16(5-2)8-6-12-7-9-17-11-13-10(3)14-15-11/h12H,4-9H2,1-3H3,(H,13,14,15) |
| InChIKey | ADXUXBGZUFTMCJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|