C8H11N7S — CID 91761860
N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,5-triazin-2-amine (PubChem CID 91761860) has the molecular formula C8H11N7S and a molecular weight of 237.29 g/mol. Its IUPAC name is N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,5-triazin-2-amine.
| Compound Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 91761860 |
| Molecular Formula | C8H11N7S |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N-[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,5-triazin-2-amine |
| SMILES | Cc1nc(SCCNc2ncncn2)n[nH]1 |
| InChI | InChI=1S/C8H11N7S/c1-6-13-8(15-14-6)16-3-2-10-7-11-4-9-5-12-7/h4-5H,2-3H2,1H3,(H,13,14,15)(H,9,10,11,12) |
| InChIKey | ODFBPYQFYCPWTH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|