C7H13N3OS — CID 61346098
4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]butan-1-ol (PubChem CID 61346098) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]butan-1-ol.
| Compound Name | 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 61346098 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]butan-1-ol |
| SMILES | Cc1nc(SCCCCO)n[nH]1 |
| InChI | InChI=1S/C7H13N3OS/c1-6-8-7(10-9-6)12-5-3-2-4-11/h11H,2-5H2,1H3,(H,8,9,10) |
| InChIKey | QPLPDHOCOSDVKW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|