C6H11N3OS — CID 83478143
2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanol (PubChem CID 83478143) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanol.
| Compound Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanol |
|---|---|
| PubChem CID | 83478143 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]ethanol |
| SMILES | CCc1nc(SCCO)n[nH]1 |
| InChI | InChI=1S/C6H11N3OS/c1-2-5-7-6(9-8-5)11-4-3-10/h10H,2-4H2,1H3,(H,7,8,9) |
| InChIKey | RMEUXBAXPMRAGZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |