C12H13IN4OS — CID 2981189
2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodophenyl)acetamide (PubChem CID 2981189) has the molecular formula C12H13IN4OS and a molecular weight of 388.23 g/mol. Its IUPAC name is 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 2981189 |
| Molecular Formula | C12H13IN4OS |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-(4-iodophenyl)acetamide |
| SMILES | CCc1nc(SCC(=O)Nc2ccc(I)cc2)n[nH]1 |
| InChI | InChI=1S/C12H13IN4OS/c1-2-10-15-12(17-16-10)19-7-11(18)14-9-5-3-8(13)4-6-9/h3-6H,2,7H2,1H3,(H,14,18)(H,15,16,17) |
| InChIKey | DZOVWUJWCJOIPD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|