C13H13N4O3S- — CID 2048851
3-[[2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 2048851) has the molecular formula C13H13N4O3S- and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-[[2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | 3-[[2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2048851 |
| Molecular Formula | C13H13N4O3S- |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-[[2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CCc1nc(SCC(=O)Nc2cccc(C(=O)[O-])c2)n[nH]1 |
| InChI | InChI=1S/C13H14N4O3S/c1-2-10-15-13(17-16-10)21-7-11(18)14-9-5-3-4-8(6-9)12(19)20/h3-6H,2,7H2,1H3,(H,14,18)(H,19,20)(H,15,16,17)/p-1 |
| InChIKey | JJBVENHKGJXLHJ-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |