C15H14KN3O3S — CID 44889725
potassium 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]benzoate (PubChem CID 44889725) has the molecular formula C15H14KN3O3S and a molecular weight of 355.46 g/mol. Its IUPAC name is potassium 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | potassium 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 44889725 |
| Molecular Formula | C15H14KN3O3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | potassium 3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]benzoate |
| SMILES | Cc1cc(C)nc(SCC(=O)Nc2cccc(C(=O)[O-])c2)n1.[K+] |
| InChI | InChI=1S/C15H15N3O3S.K/c1-9-6-10(2)17-15(16-9)22-8-13(19)18-12-5-3-4-11(7-12)14(20)21;/h3-7H,8H2,1-2H3,(H,18,19)(H,20,21);/q;+1/p-1 |
| InChIKey | HXSNYLKNAANSEU-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 95.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |