C6H10N4OS — CID 799700
2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 799700) has the molecular formula C6H10N4OS and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 799700 |
| Molecular Formula | C6H10N4OS |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | CCc1nc(SCC(N)=O)n[nH]1 |
| InChI | InChI=1S/C6H10N4OS/c1-2-5-8-6(10-9-5)12-3-4(7)11/h2-3H2,1H3,(H2,7,11)(H,8,9,10) |
| InChIKey | MQHCLKQOJIICLH-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |