C9H17N5O3S2 — CID 50957478
2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(methanesulfonamido)ethyl]acetamide (PubChem CID 50957478) has the molecular formula C9H17N5O3S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(methanesulfonamido)ethyl]acetamide.
| Compound Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(methanesulfonamido)ethyl]acetamide |
|---|---|
| PubChem CID | 50957478 |
| Molecular Formula | C9H17N5O3S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-[(5-ethyl-1H-1,2,4-triazol-3-yl)sulfanyl]-N-[2-(methanesulfonamido)ethyl]acetamide |
| SMILES | CCc1nc(SCC(=O)NCCNS(C)(=O)=O)n[nH]1 |
| InChI | InChI=1S/C9H17N5O3S2/c1-3-7-12-9(14-13-7)18-6-8(15)10-4-5-11-19(2,16)17/h11H,3-6H2,1-2H3,(H,10,15)(H,12,13,14) |
| InChIKey | NKLDMELXIVOCEO-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|