C5H8N6S — CID 61397062
3-(2-azidoethylsulfanyl)-5-methyl-1H-1,2,4-triazole (PubChem CID 61397062) has the molecular formula C5H8N6S and a molecular weight of 184.23 g/mol. Its IUPAC name is 3-(2-azidoethylsulfanyl)-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-(2-azidoethylsulfanyl)-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 61397062 |
| Molecular Formula | C5H8N6S |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 3-(2-azidoethylsulfanyl)-5-methyl-1H-1,2,4-triazole |
| SMILES | Cc1nc(SCCN=[N+]=[N-])n[nH]1 |
| InChI | InChI=1S/C5H8N6S/c1-4-8-5(10-9-4)12-3-2-7-11-6/h2-3H2,1H3,(H,8,9,10) |
| InChIKey | ZNRZGJFZQJAEJE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 90.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|