C6H8N4OS — CID 106924308
2-(2-azidoethylsulfanyl)-4-methyl-1,3-oxazole (PubChem CID 106924308) has the molecular formula C6H8N4OS and a molecular weight of 184.22 g/mol. Its IUPAC name is 2-(2-azidoethylsulfanyl)-4-methyl-1,3-oxazole.
| Compound Name | 2-(2-azidoethylsulfanyl)-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 106924308 |
| Molecular Formula | C6H8N4OS |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 2-(2-azidoethylsulfanyl)-4-methyl-1,3-oxazole |
| SMILES | Cc1coc(SCCN=[N+]=[N-])n1 |
| InChI | InChI=1S/C6H8N4OS/c1-5-4-11-6(9-5)12-3-2-8-10-7/h4H,2-3H2,1H3 |
| InChIKey | YJYIOHYPJLVXRZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|