C11H19NO3S — CID 106924051
2-(3,3-diethoxypropylsulfanyl)-4-methyl-1,3-oxazole (PubChem CID 106924051) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is 2-(3,3-diethoxypropylsulfanyl)-4-methyl-1,3-oxazole.
| Compound Name | 2-(3,3-diethoxypropylsulfanyl)-4-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 106924051 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-(3,3-diethoxypropylsulfanyl)-4-methyl-1,3-oxazole |
| SMILES | CCOC(CCSc1nc(C)co1)OCC |
| InChI | InChI=1S/C11H19NO3S/c1-4-13-10(14-5-2)6-7-16-11-12-9(3)8-15-11/h8,10H,4-7H2,1-3H3 |
| InChIKey | FLWUGQIDISMKJB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|