C8H13NO2S — CID 106923608
4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]butan-2-ol (PubChem CID 106923608) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]butan-2-ol.
| Compound Name | 4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]butan-2-ol |
|---|---|
| PubChem CID | 106923608 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 4-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]butan-2-ol |
| SMILES | Cc1coc(SCCC(C)O)n1 |
| InChI | InChI=1S/C8H13NO2S/c1-6-5-11-8(9-6)12-4-3-7(2)10/h5,7,10H,3-4H2,1-2H3 |
| InChIKey | XJENCRRVALZUBZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |